C15H23ClO2Si — CID 57187117
1-(4-chlorophenyl)-3,3-dimethyl-2-trimethylsilyloxybutan-1-one (PubChem CID 57187117) has the molecular formula C15H23ClO2Si and a molecular weight of 298.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3,3-dimethyl-2-trimethylsilyloxybutan-1-one.
| Compound Name | 1-(4-chlorophenyl)-3,3-dimethyl-2-trimethylsilyloxybutan-1-one |
|---|---|
| PubChem CID | 57187117 |
| Molecular Formula | C15H23ClO2Si |
| Molecular Weight | 298.89 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3,3-dimethyl-2-trimethylsilyloxybutan-1-one |
| SMILES | CC(C)(C)C(O[Si](C)(C)C)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H23ClO2Si/c1-15(2,3)14(18-19(4,5)6)13(17)11-7-9-12(16)10-8-11/h7-10,14H,1-6H3 |
| InChIKey | NJFROIPTFYGZDC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.89 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|