C14H25FO2Si — CID 11747712
[(6Z)-2-fluoro-3-methyl-8-trimethylsilylocta-1,6-dien-3-yl] acetate (PubChem CID 11747712) has the molecular formula C14H25FO2Si and a molecular weight of 272.44 g/mol. Its IUPAC name is [(6Z)-2-fluoro-3-methyl-8-trimethylsilylocta-1,6-dien-3-yl] acetate.
| Compound Name | [(6Z)-2-fluoro-3-methyl-8-trimethylsilylocta-1,6-dien-3-yl] acetate |
|---|---|
| PubChem CID | 11747712 |
| Molecular Formula | C14H25FO2Si |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | [(6Z)-2-fluoro-3-methyl-8-trimethylsilylocta-1,6-dien-3-yl] acetate |
| SMILES | C=C(F)C(C)(CC/C=C\C[Si](C)(C)C)OC(C)=O |
| InChI | InChI=1S/C14H25FO2Si/c1-12(15)14(3,17-13(2)16)10-8-7-9-11-18(4,5)6/h7,9H,1,8,10-11H2,2-6H3/b9-7- |
| InChIKey | GBDWORMUWMWCNJ-CLFYSBASSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|