C22H36O2 — CID 173280179
(2,7-dimethyl-3,6-dimethylidenehexadeca-1,9-dien-7-yl) acetate (PubChem CID 173280179) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (2,7-dimethyl-3,6-dimethylidenehexadeca-1,9-dien-7-yl) acetate.
| Compound Name | (2,7-dimethyl-3,6-dimethylidenehexadeca-1,9-dien-7-yl) acetate |
|---|---|
| PubChem CID | 173280179 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (2,7-dimethyl-3,6-dimethylidenehexadeca-1,9-dien-7-yl) acetate |
| SMILES | C=C(C)C(=C)CCC(=C)C(C)(CC=CCCCCCC)OC(C)=O |
| InChI | InChI=1S/C22H36O2/c1-8-9-10-11-12-13-14-17-22(7,24-21(6)23)20(5)16-15-19(4)18(2)3/h13-14H,2,4-5,8-12,15-17H2,1,3,6-7H3 |
| InChIKey | HJFMIGGJWULBEH-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|