C12H15NO3S2 — CID 11748120
methyl (2S,3R)-3-hydroxy-2-(methylsulfanylcarbothioylamino)-3-phenylpropanoate (PubChem CID 11748120) has the molecular formula C12H15NO3S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is methyl (2S,3R)-3-hydroxy-2-(methylsulfanylcarbothioylamino)-3-phenylpropanoate.
| Compound Name | methyl (2S,3R)-3-hydroxy-2-(methylsulfanylcarbothioylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 11748120 |
| Molecular Formula | C12H15NO3S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | methyl (2S,3R)-3-hydroxy-2-(methylsulfanylcarbothioylamino)-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](NC(=S)SC)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO3S2/c1-16-11(15)9(13-12(17)18-2)10(14)8-6-4-3-5-7-8/h3-7,9-10,14H,1-2H3,(H,13,17)/t9-,10+/m0/s1 |
| InChIKey | ABVISGLEZQTVKY-VHSXEESVSA-N |
| XLogP | 1.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|