C9H6BrN3O4 — CID 117482805
4-(5-amino-1,2-oxazol-4-yl)-2-bromo-6-nitrophenol (PubChem CID 117482805) has the molecular formula C9H6BrN3O4 and a molecular weight of 300.07 g/mol. Its IUPAC name is 4-(5-amino-1,2-oxazol-4-yl)-2-bromo-6-nitrophenol.
| Compound Name | 4-(5-amino-1,2-oxazol-4-yl)-2-bromo-6-nitrophenol |
|---|---|
| PubChem CID | 117482805 |
| Molecular Formula | C9H6BrN3O4 |
| Molecular Weight | 300.07 g/mol |
| Exact Mass | 298.95 |
| IUPAC Name | 4-(5-amino-1,2-oxazol-4-yl)-2-bromo-6-nitrophenol |
| SMILES | Nc1oncc1-c1cc(Br)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H6BrN3O4/c10-6-1-4(5-3-12-17-9(5)11)2-7(8(6)14)13(15)16/h1-3,14H,11H2 |
| InChIKey | OPBREBSLENVODK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.07 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|