C10H6BrN3O5 — CID 136998120
3-(3-bromo-4-hydroxy-5-nitrophenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 136998120) has the molecular formula C10H6BrN3O5 and a molecular weight of 328.08 g/mol. Its IUPAC name is 3-(3-bromo-4-hydroxy-5-nitrophenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(3-bromo-4-hydroxy-5-nitrophenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 136998120 |
| Molecular Formula | C10H6BrN3O5 |
| Molecular Weight | 328.08 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | 3-(3-bromo-4-hydroxy-5-nitrophenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc(Br)c(O)c([N+](=O)[O-])c2)n[nH]1 |
| InChI | InChI=1S/C10H6BrN3O5/c11-5-1-4(2-8(9(5)15)14(18)19)6-3-7(10(16)17)13-12-6/h1-3,15H,(H,12,13)(H,16,17) |
| InChIKey | ZLWGJRCBDBKCMG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 129.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.08 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|