C12H18ClNO6 — CID 11748822
(3aS,4S,6R,6aS)-4-chloro-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-nitroso-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole (PubChem CID 11748822) has the molecular formula C12H18ClNO6 and a molecular weight of 307.73 g/mol. Its IUPAC name is (3aS,4S,6R,6aS)-4-chloro-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-nitroso-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole.
| Compound Name | (3aS,4S,6R,6aS)-4-chloro-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-nitroso-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 11748822 |
| Molecular Formula | C12H18ClNO6 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (3aS,4S,6R,6aS)-4-chloro-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-4-nitroso-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole |
| SMILES | CC1(C)OC[C@@H]([C@H]2O[C@@](Cl)(N=O)[C@H]3OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C12H18ClNO6/c1-10(2)16-5-6(17-10)7-8-9(12(13,14-15)19-7)20-11(3,4)18-8/h6-9H,5H2,1-4H3/t6-,7+,8-,9-,12-/m0/s1 |
| InChIKey | VXEARSPYYHFGDA-WZQRHETMSA-N |
| XLogP | 1.72 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|