C21H30N2O4 — CID 11749168
(5S,6R)-3-[(2S,3R)-3-cyclohexyl-3-hydroxy-2-methylpropanoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one (PubChem CID 11749168) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is (5S,6R)-3-[(2S,3R)-3-cyclohexyl-3-hydroxy-2-methylpropanoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one.
| Compound Name | (5S,6R)-3-[(2S,3R)-3-cyclohexyl-3-hydroxy-2-methylpropanoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one |
|---|---|
| PubChem CID | 11749168 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (5S,6R)-3-[(2S,3R)-3-cyclohexyl-3-hydroxy-2-methylpropanoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one |
| SMILES | C[C@H](C(=O)N1C(=O)O[C@H](c2ccccc2)[C@H](C)N1C)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C21H30N2O4/c1-14(18(24)16-10-6-4-7-11-16)20(25)23-21(26)27-19(15(2)22(23)3)17-12-8-5-9-13-17/h5,8-9,12-16,18-19,24H,4,6-7,10-11H2,1-3H3/t14-,15-,18-,19-/m0/s1 |
| InChIKey | ZXHFSGTZJKUETK-LNMJFAINSA-N |
| XLogP | 3.52 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |