About (2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone
(2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone (PubChem CID 11749455) has the molecular formula C22H25ClN2O2
and a molecular weight of 384.91 g/mol. Its IUPAC name is (2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone.
Molecular Properties
| Compound Name | (2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone |
| PubChem CID | 11749455 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone |
| SMILES | CC(O)CN1CCC2(CC1)CN(C(=O)c1ccccc1Cl)c1ccccc12 |
| InChI | InChI=1S/C22H25ClN2O2/c1-16(26)14-24-12-10-22(11-13-24)15-25(20-9-5-3-7-18(20)22)21(27)17-6-2-4-8-19(17)23/h2-9,16,26H,10-15H2,1H3 |
| InChIKey | JJWXTXGZLFYAPC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone?
The IUPAC name of (2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone (CID 11749455) is (2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone.
What is the SMILES notation for (2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone?
The canonical SMILES for (2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone is CC(O)CN1CCC2(CC1)CN(C(=O)c1ccccc1Cl)c1ccccc12.
What is the InChIKey of (2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone?
The InChIKey is JJWXTXGZLFYAPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25ClN2O2/c1-16(26)14-24-12-10-22(11-13-24)15-25(20-9-5-3-7-18(20)22)21(27)17-6-2-4-8-19(17)23/h2-9,16,26H,10-15H2,1H3.
What are the key properties of (2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone?
(2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone has a molecular weight of 384.91 g/mol, XLogP of 3.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)-[1'-(2-hydroxypropyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone is sourced from PubChem (CID 11749455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).