About 1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one
1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one (PubChem CID 59003991) has the molecular formula C23H23ClF2N2O2
and a molecular weight of 432.90 g/mol. Its IUPAC name is 1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one.
Molecular Properties
| Compound Name | 1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one |
| PubChem CID | 59003991 |
| Molecular Formula | C23H23ClF2N2O2 |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one |
| SMILES | CCC(=O)CN1CCC2(CC1)CN(C(=O)c1cccc(F)c1F)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C23H23ClF2N2O2/c1-2-16(29)13-27-10-8-23(9-11-27)14-28(20-7-6-15(24)12-18(20)23)22(30)17-4-3-5-19(25)21(17)26/h3-7,12H,2,8-11,13-14H2,1H3 |
| InChIKey | WZGUYTWXXIQFJE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one?
The IUPAC name of 1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one (CID 59003991) is 1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one.
What is the SMILES notation for 1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one?
The canonical SMILES for 1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one is CCC(=O)CN1CCC2(CC1)CN(C(=O)c1cccc(F)c1F)c1ccc(Cl)cc12.
What is the InChIKey of 1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one?
The InChIKey is WZGUYTWXXIQFJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23ClF2N2O2/c1-2-16(29)13-27-10-8-23(9-11-27)14-28(20-7-6-15(24)12-18(20)23)22(30)17-4-3-5-19(25)21(17)26/h3-7,12H,2,8-11,13-14H2,1H3.
What are the key properties of 1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one?
1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one has a molecular weight of 432.90 g/mol, XLogP of 4.59, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-chloro-1-(2,3-difluorobenzoyl)spiro[2H-indole-3,4'-piperidine]-1'-yl]butan-2-one is sourced from PubChem (CID 59003991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).