C25H25F7N2O — CID 15983292
(2,6-difluorophenyl)-[1'-(2,2,3,3,3-pentafluoropropyl)-5-propan-2-ylspiro[2H-indole-3,4'-piperidine]-1-yl]methanone (PubChem CID 15983292) has the molecular formula C25H25F7N2O and a molecular weight of 502.47 g/mol. Its IUPAC name is (2,6-difluorophenyl)-[1'-(2,2,3,3,3-pentafluoropropyl)-5-propan-2-ylspiro[2H-indole-3,4'-piperidine]-1-yl]methanone.
| Compound Name | (2,6-difluorophenyl)-[1'-(2,2,3,3,3-pentafluoropropyl)-5-propan-2-ylspiro[2H-indole-3,4'-piperidine]-1-yl]methanone |
|---|---|
| PubChem CID | 15983292 |
| Molecular Formula | C25H25F7N2O |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | (2,6-difluorophenyl)-[1'-(2,2,3,3,3-pentafluoropropyl)-5-propan-2-ylspiro[2H-indole-3,4'-piperidine]-1-yl]methanone |
| SMILES | CC(C)c1ccc2c(c1)C1(CCN(CC(F)(F)C(F)(F)F)CC1)CN2C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C25H25F7N2O/c1-15(2)16-6-7-20-17(12-16)23(8-10-33(11-9-23)14-24(28,29)25(30,31)32)13-34(20)22(35)21-18(26)4-3-5-19(21)27/h3-7,12,15H,8-11,13-14H2,1-2H3 |
| InChIKey | IIVKVLRVSCGYKE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|