C25H27ClF2N2O — CID 59003988
(5-chloro-1'-hex-5-enylspiro[2H-indole-3,4'-piperidine]-1-yl)-(2,6-difluorophenyl)methanone (PubChem CID 59003988) has the molecular formula C25H27ClF2N2O and a molecular weight of 444.95 g/mol. Its IUPAC name is (5-chloro-1'-hex-5-enylspiro[2H-indole-3,4'-piperidine]-1-yl)-(2,6-difluorophenyl)methanone.
| Compound Name | (5-chloro-1'-hex-5-enylspiro[2H-indole-3,4'-piperidine]-1-yl)-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 59003988 |
| Molecular Formula | C25H27ClF2N2O |
| Molecular Weight | 444.95 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | (5-chloro-1'-hex-5-enylspiro[2H-indole-3,4'-piperidine]-1-yl)-(2,6-difluorophenyl)methanone |
| SMILES | C=CCCCCN1CCC2(CC1)CN(C(=O)c1c(F)cccc1F)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C25H27ClF2N2O/c1-2-3-4-5-13-29-14-11-25(12-15-29)17-30(22-10-9-18(26)16-19(22)25)24(31)23-20(27)7-6-8-21(23)28/h2,6-10,16H,1,3-5,11-15,17H2 |
| InChIKey | FTEKCKZKWPDXJH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.95 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|