C14H26INO4 — CID 11749969
tert-butyl N-(1,1-dideuterio-4-iodobutyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 11749969) has the molecular formula C14H26INO4 and a molecular weight of 401.28 g/mol. Its IUPAC name is tert-butyl N-(1,1-dideuterio-4-iodobutyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-(1,1-dideuterio-4-iodobutyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 11749969 |
| Molecular Formula | C14H26INO4 |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | tert-butyl N-(1,1-dideuterio-4-iodobutyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | [2H]C([2H])(CCCI)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H26INO4/c1-13(2,3)19-11(17)16(10-8-7-9-15)12(18)20-14(4,5)6/h7-10H2,1-6H3/i10D2 |
| InChIKey | KZPDRPDEUMMFSW-KBMKNGFXSA-N |
| XLogP | 4.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|