C20H22Cl2N2O4S2 — CID 11752168
4-chloro-N-[(2S,3S)-3-[[(4-chlorophenyl)sulfonylamino]methyl]-2-ethenylpent-4-enyl]benzenesulfonamide (PubChem CID 11752168) has the molecular formula C20H22Cl2N2O4S2 and a molecular weight of 489.45 g/mol. Its IUPAC name is 4-chloro-N-[(2S,3S)-3-[[(4-chlorophenyl)sulfonylamino]methyl]-2-ethenylpent-4-enyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(2S,3S)-3-[[(4-chlorophenyl)sulfonylamino]methyl]-2-ethenylpent-4-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11752168 |
| Molecular Formula | C20H22Cl2N2O4S2 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | 4-chloro-N-[(2S,3S)-3-[[(4-chlorophenyl)sulfonylamino]methyl]-2-ethenylpent-4-enyl]benzenesulfonamide |
| SMILES | C=CC(CNS(=O)(=O)c1ccc(Cl)cc1)[C@H](C=C)CNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O4S2/c1-3-15(13-23-29(25,26)19-9-5-17(21)6-10-19)16(4-2)14-24-30(27,28)20-11-7-18(22)8-12-20/h3-12,15-16,23-24H,1-2,13-14H2/t15-,16?/m1/s1 |
| InChIKey | UWQPLEVVHYIKPJ-AAFJCEBUSA-N |
| XLogP | 3.85 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|