C9H8Cl2N2O2S — CID 1210342
4-chloro-N-[(2S)-2-chloro-2-cyanoethyl]benzenesulfonamide (PubChem CID 1210342) has the molecular formula C9H8Cl2N2O2S and a molecular weight of 279.15 g/mol. Its IUPAC name is 4-chloro-N-[(2S)-2-chloro-2-cyanoethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(2S)-2-chloro-2-cyanoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1210342 |
| Molecular Formula | C9H8Cl2N2O2S |
| Molecular Weight | 279.15 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | 4-chloro-N-[(2S)-2-chloro-2-cyanoethyl]benzenesulfonamide |
| SMILES | N#C[C@@H](Cl)CNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H8Cl2N2O2S/c10-7-1-3-9(4-2-7)16(14,15)13-6-8(11)5-12/h1-4,8,13H,6H2/t8-/m1/s1 |
| InChIKey | UPRVAJNQWSDYRS-MRVPVSSYSA-N |
| XLogP | 1.75 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|