C29H34N2O7 — CID 11756509
tert-butyl 2-[(3R,5E)-3-benzyl-5-(2-ethoxy-2-oxoethylidene)-2-oxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]acetate (PubChem CID 11756509) has the molecular formula C29H34N2O7 and a molecular weight of 522.60 g/mol. Its IUPAC name is tert-butyl 2-[(3R,5E)-3-benzyl-5-(2-ethoxy-2-oxoethylidene)-2-oxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,5E)-3-benzyl-5-(2-ethoxy-2-oxoethylidene)-2-oxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 11756509 |
| Molecular Formula | C29H34N2O7 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | tert-butyl 2-[(3R,5E)-3-benzyl-5-(2-ethoxy-2-oxoethylidene)-2-oxo-3-(phenylmethoxycarbonylamino)pyrrolidin-1-yl]acetate |
| SMILES | CCOC(=O)/C=C1\C[C@@](Cc2ccccc2)(NC(=O)OCc2ccccc2)C(=O)N1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H34N2O7/c1-5-36-24(32)16-23-18-29(17-21-12-8-6-9-13-21,26(34)31(23)19-25(33)38-28(2,3)4)30-27(35)37-20-22-14-10-7-11-15-22/h6-16H,5,17-20H2,1-4H3,(H,30,35)/b23-16+/t29-/m1/s1 |
| InChIKey | FRXIHXOBSCTEGI-DGBUWDJXSA-N |
| XLogP | 3.92 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|