C20H31NSi — CID 11756865
[(3aR,7aR)-1-benzyl-3a-methyl-2,4,5,6,7,7a-hexahydroindol-3-ylidene]methyl-trimethylsilane (PubChem CID 11756865) has the molecular formula C20H31NSi and a molecular weight of 313.56 g/mol. Its IUPAC name is [(3aR,7aR)-1-benzyl-3a-methyl-2,4,5,6,7,7a-hexahydroindol-3-ylidene]methyl-trimethylsilane.
| Compound Name | [(3aR,7aR)-1-benzyl-3a-methyl-2,4,5,6,7,7a-hexahydroindol-3-ylidene]methyl-trimethylsilane |
|---|---|
| PubChem CID | 11756865 |
| Molecular Formula | C20H31NSi |
| Molecular Weight | 313.56 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | [(3aR,7aR)-1-benzyl-3a-methyl-2,4,5,6,7,7a-hexahydroindol-3-ylidene]methyl-trimethylsilane |
| SMILES | C[C@]12CCCC[C@H]1N(Cc1ccccc1)CC2=C[Si](C)(C)C |
| InChI | InChI=1S/C20H31NSi/c1-20-13-9-8-12-19(20)21(14-17-10-6-5-7-11-17)15-18(20)16-22(2,3)4/h5-7,10-11,16,19H,8-9,12-15H2,1-4H3/t19-,20-/m1/s1 |
| InChIKey | XEIXWHZSJGRXGL-WOJBJXKFSA-N |
| XLogP | 5.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|