C19H31NSi — CID 162980446
(4a-methyl-2,3,4,9a-tetrahydro-1H-carbazol-9-yl)-tert-butyl-dimethylsilane (PubChem CID 162980446) has the molecular formula C19H31NSi and a molecular weight of 301.55 g/mol. Its IUPAC name is (4a-methyl-2,3,4,9a-tetrahydro-1H-carbazol-9-yl)-tert-butyl-dimethylsilane.
| Compound Name | (4a-methyl-2,3,4,9a-tetrahydro-1H-carbazol-9-yl)-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 162980446 |
| Molecular Formula | C19H31NSi |
| Molecular Weight | 301.55 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | (4a-methyl-2,3,4,9a-tetrahydro-1H-carbazol-9-yl)-tert-butyl-dimethylsilane |
| SMILES | CC12CCCCC1N([Si](C)(C)C(C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C19H31NSi/c1-18(2,3)21(5,6)20-16-12-8-7-11-15(16)19(4)14-10-9-13-17(19)20/h7-8,11-12,17H,9-10,13-14H2,1-6H3 |
| InChIKey | OLMHIBRDQFXVLW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|