C30H37BF2N4O4 — CID 11757661
(2S)-3-[4-[6-[3-[(5Z)-5-[(1-difluoroboranyl-3,5-dimethylpyrrol-2-yl)methylidene]pyrrol-2-yl]propanoylamino]hexanoylamino]phenyl]-2-methylpropanoic acid (PubChem CID 11757661) has the molecular formula C30H37BF2N4O4 and a molecular weight of 566.46 g/mol. Its IUPAC name is (2S)-3-[4-[6-[3-[(5Z)-5-[(1-difluoroboranyl-3,5-dimethylpyrrol-2-yl)methylidene]pyrrol-2-yl]propanoylamino]hexanoylamino]phenyl]-2-methylpropanoic acid.
| Compound Name | (2S)-3-[4-[6-[3-[(5Z)-5-[(1-difluoroboranyl-3,5-dimethylpyrrol-2-yl)methylidene]pyrrol-2-yl]propanoylamino]hexanoylamino]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11757661 |
| Molecular Formula | C30H37BF2N4O4 |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | (2S)-3-[4-[6-[3-[(5Z)-5-[(1-difluoroboranyl-3,5-dimethylpyrrol-2-yl)methylidene]pyrrol-2-yl]propanoylamino]hexanoylamino]phenyl]-2-methylpropanoic acid |
| SMILES | Cc1cc(C)n(B(F)F)c1/C=C1/C=CC(CCC(=O)NCCCCCC(=O)Nc2ccc(C[C@H](C)C(=O)O)cc2)=N1 |
| InChI | InChI=1S/C30H37BF2N4O4/c1-20-17-22(3)37(31(32)33)27(20)19-26-13-12-24(35-26)14-15-28(38)34-16-6-4-5-7-29(39)36-25-10-8-23(9-11-25)18-21(2)30(40)41/h8-13,17,19,21H,4-7,14-16,18H2,1-3H3,(H,34,38)(H,36,39)(H,40,41)/b26-19-/t21-/m0/s1 |
| InChIKey | RVJBQPILKTUFOV-UZPCJBMISA-N |
| XLogP | 5.59 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|