C19H28N2O4 — CID 120541449
3-[4-[4-(2,2-dimethylpropanoylamino)butanoylamino]phenyl]-2-methylpropanoic acid (PubChem CID 120541449) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 3-[4-[4-(2,2-dimethylpropanoylamino)butanoylamino]phenyl]-2-methylpropanoic acid.
| Compound Name | 3-[4-[4-(2,2-dimethylpropanoylamino)butanoylamino]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120541449 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 3-[4-[4-(2,2-dimethylpropanoylamino)butanoylamino]phenyl]-2-methylpropanoic acid |
| SMILES | CC(Cc1ccc(NC(=O)CCCNC(=O)C(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C19H28N2O4/c1-13(17(23)24)12-14-7-9-15(10-8-14)21-16(22)6-5-11-20-18(25)19(2,3)4/h7-10,13H,5-6,11-12H2,1-4H3,(H,20,25)(H,21,22)(H,23,24) |
| InChIKey | WSVDMGIJAMVRLT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|