C27H38N2O2 — CID 127037570
N-(4-tert-butylphenyl)-4-[2-[4-(2-methylpropyl)phenyl]propanoylamino]butanamide (PubChem CID 127037570) has the molecular formula C27H38N2O2 and a molecular weight of 422.61 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-[2-[4-(2-methylpropyl)phenyl]propanoylamino]butanamide.
| Compound Name | N-(4-tert-butylphenyl)-4-[2-[4-(2-methylpropyl)phenyl]propanoylamino]butanamide |
|---|---|
| PubChem CID | 127037570 |
| Molecular Formula | C27H38N2O2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-[2-[4-(2-methylpropyl)phenyl]propanoylamino]butanamide |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)NCCCC(=O)Nc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H38N2O2/c1-19(2)18-21-9-11-22(12-10-21)20(3)26(31)28-17-7-8-25(30)29-24-15-13-23(14-16-24)27(4,5)6/h9-16,19-20H,7-8,17-18H2,1-6H3,(H,28,31)(H,29,30) |
| InChIKey | JUTXDMYMFUTCGU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|