C31H37BF2N4O8 — CID 10439148
2-[bis(carboxymethyl)amino]-6-[3-[1-difluoroboranyl-5-[(Z)-[5-(4-methoxyphenyl)pyrrol-2-ylidene]methyl]-2,4-dimethylpyrrol-3-yl]propanoylamino]hexanoic acid (PubChem CID 10439148) has the molecular formula C31H37BF2N4O8 and a molecular weight of 642.47 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-6-[3-[1-difluoroboranyl-5-[(Z)-[5-(4-methoxyphenyl)pyrrol-2-ylidene]methyl]-2,4-dimethylpyrrol-3-yl]propanoylamino]hexanoic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-6-[3-[1-difluoroboranyl-5-[(Z)-[5-(4-methoxyphenyl)pyrrol-2-ylidene]methyl]-2,4-dimethylpyrrol-3-yl]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 10439148 |
| Molecular Formula | C31H37BF2N4O8 |
| Molecular Weight | 642.47 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-6-[3-[1-difluoroboranyl-5-[(Z)-[5-(4-methoxyphenyl)pyrrol-2-ylidene]methyl]-2,4-dimethylpyrrol-3-yl]propanoylamino]hexanoic acid |
| SMILES | COc1ccc(C2=N/C(=C\c3c(C)c(CCC(=O)NCCCCC(C(=O)O)N(CC(=O)O)CC(=O)O)c(C)n3B(F)F)C=C2)cc1 |
| InChI | InChI=1S/C31H37BF2N4O8/c1-19-24(12-14-28(39)35-15-5-4-6-26(31(44)45)37(17-29(40)41)18-30(42)43)20(2)38(32(33)34)27(19)16-22-9-13-25(36-22)21-7-10-23(46-3)11-8-21/h7-11,13,16,26H,4-6,12,14-15,17-18H2,1-3H3,(H,35,39)(H,40,41)(H,42,43)(H,44,45)/b22-16- |
| InChIKey | RYNFYBFNNAYBNO-JWGURIENSA-N |
| XLogP | 3.43 |
| TPSA | 170.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|