C25H43N3O7SSi2 — CID 11758048
1-[(5S,6R,8S,9R)-4-amino-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3-phenylurea (PubChem CID 11758048) has the molecular formula C25H43N3O7SSi2 and a molecular weight of 585.87 g/mol. Its IUPAC name is 1-[(5S,6R,8S,9R)-4-amino-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3-phenylurea.
| Compound Name | 1-[(5S,6R,8S,9R)-4-amino-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3-phenylurea |
|---|---|
| PubChem CID | 11758048 |
| Molecular Formula | C25H43N3O7SSi2 |
| Molecular Weight | 585.87 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | 1-[(5S,6R,8S,9R)-4-amino-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3-phenylurea |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1O[C@H](NC(=O)Nc2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@]12OS(=O)(=O)C=C2N |
| InChI | InChI=1S/C25H43N3O7SSi2/c1-23(2,3)37(7,8)33-19-20(28-22(29)27-17-14-12-11-13-15-17)32-21(34-38(9,10)24(4,5)6)25(19)18(26)16-36(30,31)35-25/h11-16,19-21H,26H2,1-10H3,(H2,27,28,29)/t19-,20-,21+,25-/m0/s1 |
| InChIKey | PCQGBYJBYBZCSO-HULNYRCFSA-N |
| XLogP | 4.80 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.87 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|