C23H42N4O7SSi2 — CID 137324142
4-amino-1-[(6R,8R)-4-amino-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-5-methylpyrimidin-2-one (PubChem CID 137324142) has the molecular formula C23H42N4O7SSi2 and a molecular weight of 574.85 g/mol. Its IUPAC name is 4-amino-1-[(6R,8R)-4-amino-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-5-methylpyrimidin-2-one.
| Compound Name | 4-amino-1-[(6R,8R)-4-amino-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-5-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 137324142 |
| Molecular Formula | C23H42N4O7SSi2 |
| Molecular Weight | 574.85 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 4-amino-1-[(6R,8R)-4-amino-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-5-methylpyrimidin-2-one |
| SMILES | Cc1cn([C@@H]2O[C@H](O[Si](C)(C)C(C)(C)C)C3(OS(=O)(=O)C=C3N)C2O[Si](C)(C)C(C)(C)C)c(=O)nc1N |
| InChI | InChI=1S/C23H42N4O7SSi2/c1-14-12-27(20(28)26-17(14)25)18-16(32-36(8,9)21(2,3)4)23(15(24)13-35(29,30)34-23)19(31-18)33-37(10,11)22(5,6)7/h12-13,16,18-19H,24H2,1-11H3,(H2,25,26,28)/t16?,18-,19-,23?/m1/s1 |
| InChIKey | NTAXTNMDOZZEMU-VROYJQPTSA-N |
| XLogP | 3.30 |
| TPSA | 157.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.85 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|