C23H33NO2 — CID 11760059
(2R)-2-[(2S)-1-[(4R)-4-methyloct-2-ynyl]pyrrolidin-2-yl]-2-phenylmethoxypropanal (PubChem CID 11760059) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is (2R)-2-[(2S)-1-[(4R)-4-methyloct-2-ynyl]pyrrolidin-2-yl]-2-phenylmethoxypropanal.
| Compound Name | (2R)-2-[(2S)-1-[(4R)-4-methyloct-2-ynyl]pyrrolidin-2-yl]-2-phenylmethoxypropanal |
|---|---|
| PubChem CID | 11760059 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | (2R)-2-[(2S)-1-[(4R)-4-methyloct-2-ynyl]pyrrolidin-2-yl]-2-phenylmethoxypropanal |
| SMILES | CCCC[C@@H](C)C#CCN1CCC[C@H]1[C@](C)(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H33NO2/c1-4-5-11-20(2)12-9-16-24-17-10-15-22(24)23(3,19-25)26-18-21-13-7-6-8-14-21/h6-8,13-14,19-20,22H,4-5,10-11,15-18H2,1-3H3/t20-,22+,23+/m1/s1 |
| InChIKey | MTQQHEGTZNMSJB-PUHATCMVSA-N |
| XLogP | 4.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|