C22H14N4O2 — CID 11760311
1,2-bis(6-pyridin-2-yl-2-pyridinyl)ethane-1,2-dione (PubChem CID 11760311) has the molecular formula C22H14N4O2 and a molecular weight of 366.38 g/mol. Its IUPAC name is 1,2-bis(6-pyridin-2-yl-2-pyridinyl)ethane-1,2-dione.
| Compound Name | 1,2-bis(6-pyridin-2-yl-2-pyridinyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 11760311 |
| Molecular Formula | C22H14N4O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1,2-bis(6-pyridin-2-yl-2-pyridinyl)ethane-1,2-dione |
| SMILES | O=C(C(=O)c1cccc(-c2ccccn2)n1)c1cccc(-c2ccccn2)n1 |
| InChI | InChI=1S/C22H14N4O2/c27-21(19-11-5-9-17(25-19)15-7-1-3-13-23-15)22(28)20-12-6-10-18(26-20)16-8-2-4-14-24-16/h1-14H |
| InChIKey | MRZNVFUXNIVMCZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|