C29H47N3 — CID 11761926
(3aS,6aR)-2-butyl-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine] (PubChem CID 11761926) has the molecular formula C29H47N3 and a molecular weight of 437.72 g/mol. Its IUPAC name is (3aS,6aR)-2-butyl-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine].
| Compound Name | (3aS,6aR)-2-butyl-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine] |
|---|---|
| PubChem CID | 11761926 |
| Molecular Formula | C29H47N3 |
| Molecular Weight | 437.72 g/mol |
| Exact Mass | 437.38 |
| IUPAC Name | (3aS,6aR)-2-butyl-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine] |
| SMILES | CCCCN1C[C@@H]2CN(c3ccccc3)C3(CCN(C4CCC(C(C)C)CC4)CC3)[C@@H]2C1 |
| InChI | InChI=1S/C29H47N3/c1-4-5-17-30-20-25-21-32(27-9-7-6-8-10-27)29(28(25)22-30)15-18-31(19-16-29)26-13-11-24(12-14-26)23(2)3/h6-10,23-26,28H,4-5,11-22H2,1-3H3/t24?,25-,26?,28-/m1/s1 |
| InChIKey | ONYGZRIZWMUUQZ-ZCUQVLTFSA-N |
| XLogP | 5.90 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.72 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |