C21H18N4OS3 — CID 1176281
N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide (PubChem CID 1176281) has the molecular formula C21H18N4OS3 and a molecular weight of 438.60 g/mol. Its IUPAC name is N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide.
| Compound Name | N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 1176281 |
| Molecular Formula | C21H18N4OS3 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide |
| SMILES | CN(C(=O)CSc1ncnc2sc3c(c12)CCC3)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H18N4OS3/c1-25(21-24-15(10-28-21)13-6-3-2-4-7-13)17(26)11-27-19-18-14-8-5-9-16(14)29-20(18)23-12-22-19/h2-4,6-7,10,12H,5,8-9,11H2,1H3 |
| InChIKey | OIXGIJHNTSXXKD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |