C8H10N2O4 — CID 11769462
[3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl acetate (PubChem CID 11769462) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl acetate.
| Compound Name | [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 11769462 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl acetate |
| SMILES | CNC(=O)c1cc(COC(C)=O)on1 |
| InChI | InChI=1S/C8H10N2O4/c1-5(11)13-4-6-3-7(10-14-6)8(12)9-2/h3H,4H2,1-2H3,(H,9,12) |
| InChIKey | QFPNSEJDUQUEIT-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |