About [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate
[3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate (PubChem CID 66661175) has the molecular formula C14H23N5O4
and a molecular weight of 325.37 g/mol. Its IUPAC name is [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate.
Molecular Properties
| Compound Name | [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate |
| PubChem CID | 66661175 |
| Molecular Formula | C14H23N5O4 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate |
| SMILES | CNC(=O)c1cc(COC(=O)NCCC2(N(C)C)CNC2)on1 |
| InChI | InChI=1S/C14H23N5O4/c1-15-12(20)11-6-10(23-18-11)7-22-13(21)17-5-4-14(19(2)3)8-16-9-14/h6,16H,4-5,7-9H2,1-3H3,(H,15,20)(H,17,21) |
| InChIKey | WONMDBSLOHICDZ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate?
The IUPAC name of [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate (CID 66661175) is [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate.
What is the SMILES notation for [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate?
The canonical SMILES for [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate is CNC(=O)c1cc(COC(=O)NCCC2(N(C)C)CNC2)on1.
What is the InChIKey of [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate?
The InChIKey is WONMDBSLOHICDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5O4/c1-15-12(20)11-6-10(23-18-11)7-22-13(21)17-5-4-14(19(2)3)8-16-9-14/h6,16H,4-5,7-9H2,1-3H3,(H,15,20)(H,17,21).
What are the key properties of [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate?
[3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate has a molecular weight of 325.37 g/mol, XLogP of -0.45, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-[2-[3-(dimethylamino)azetidin-3-yl]ethyl]carbamate is sourced from PubChem (CID 66661175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).