C11H16O5 — CID 11770210
(1S,5S,7S)-9,9-dimethoxy-3,11-dioxatricyclo[5.3.1.01,5]undecan-8-one (PubChem CID 11770210) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (1S,5S,7S)-9,9-dimethoxy-3,11-dioxatricyclo[5.3.1.01,5]undecan-8-one.
| Compound Name | (1S,5S,7S)-9,9-dimethoxy-3,11-dioxatricyclo[5.3.1.01,5]undecan-8-one |
|---|---|
| PubChem CID | 11770210 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (1S,5S,7S)-9,9-dimethoxy-3,11-dioxatricyclo[5.3.1.01,5]undecan-8-one |
| SMILES | COC1(OC)C[C@@]23COC[C@@H]2C[C@H](O3)C1=O |
| InChI | InChI=1S/C11H16O5/c1-13-11(14-2)5-10-6-15-4-7(10)3-8(16-10)9(11)12/h7-8H,3-6H2,1-2H3/t7-,8-,10+/m0/s1 |
| InChIKey | AWHIUUHZGVKWDS-OYNCUSHFSA-N |
| XLogP | 0.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|