C16H15F2NO3 — CID 11771216
(3R)-2,2-difluoro-3-hydroxy-N-methyl-N-phenoxy-3-phenylpropanamide (PubChem CID 11771216) has the molecular formula C16H15F2NO3 and a molecular weight of 307.30 g/mol. Its IUPAC name is (3R)-2,2-difluoro-3-hydroxy-N-methyl-N-phenoxy-3-phenylpropanamide.
| Compound Name | (3R)-2,2-difluoro-3-hydroxy-N-methyl-N-phenoxy-3-phenylpropanamide |
|---|---|
| PubChem CID | 11771216 |
| Molecular Formula | C16H15F2NO3 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (3R)-2,2-difluoro-3-hydroxy-N-methyl-N-phenoxy-3-phenylpropanamide |
| SMILES | CN(Oc1ccccc1)C(=O)C(F)(F)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H15F2NO3/c1-19(22-13-10-6-3-7-11-13)15(21)16(17,18)14(20)12-8-4-2-5-9-12/h2-11,14,20H,1H3/t14-/m1/s1 |
| InChIKey | LDVHQYGMZRGHHQ-CQSZACIVSA-N |
| XLogP | 2.81 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|