C22H30N2O2 — CID 11772629
tert-butyl (2S)-5-amino-2-(benzhydrylamino)pentanoate (PubChem CID 11772629) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is tert-butyl (2S)-5-amino-2-(benzhydrylamino)pentanoate.
| Compound Name | tert-butyl (2S)-5-amino-2-(benzhydrylamino)pentanoate |
|---|---|
| PubChem CID | 11772629 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | tert-butyl (2S)-5-amino-2-(benzhydrylamino)pentanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCN)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30N2O2/c1-22(2,3)26-21(25)19(15-10-16-23)24-20(17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4-9,11-14,19-20,24H,10,15-16,23H2,1-3H3/t19-/m0/s1 |
| InChIKey | VZXZXDHKOBFEBY-IBGZPJMESA-N |
| XLogP | 3.81 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |