C19H27ClN2O6 — CID 22795574
(2S)-6-amino-2-[[1-(2-chlorophenyl)-2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]carbonylamino]hexanoic acid (PubChem CID 22795574) has the molecular formula C19H27ClN2O6 and a molecular weight of 414.89 g/mol. Its IUPAC name is (2S)-6-amino-2-[[1-(2-chlorophenyl)-2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]carbonylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[1-(2-chlorophenyl)-2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]carbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 22795574 |
| Molecular Formula | C19H27ClN2O6 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (2S)-6-amino-2-[[1-(2-chlorophenyl)-2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]carbonylamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)C(OC(=O)N[C@@H](CCCCN)C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C19H27ClN2O6/c1-19(2,3)28-17(25)15(12-8-4-5-9-13(12)20)27-18(26)22-14(16(23)24)10-6-7-11-21/h4-5,8-9,14-15H,6-7,10-11,21H2,1-3H3,(H,22,26)(H,23,24)/t14-,15?/m0/s1 |
| InChIKey | NOWZUTCFLXPCOR-MLCCFXAWSA-N |
| XLogP | 3.03 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|