C18H26INO2 — CID 11774347
2-iodo-4-methyl-N-[(1R,2R)-2-[(2-methylpropan-2-yl)oxy]cyclohexyl]benzamide (PubChem CID 11774347) has the molecular formula C18H26INO2 and a molecular weight of 415.32 g/mol. Its IUPAC name is 2-iodo-4-methyl-N-[(1R,2R)-2-[(2-methylpropan-2-yl)oxy]cyclohexyl]benzamide.
| Compound Name | 2-iodo-4-methyl-N-[(1R,2R)-2-[(2-methylpropan-2-yl)oxy]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 11774347 |
| Molecular Formula | C18H26INO2 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-iodo-4-methyl-N-[(1R,2R)-2-[(2-methylpropan-2-yl)oxy]cyclohexyl]benzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H]2CCCC[C@H]2OC(C)(C)C)c(I)c1 |
| InChI | InChI=1S/C18H26INO2/c1-12-9-10-13(14(19)11-12)17(21)20-15-7-5-6-8-16(15)22-18(2,3)4/h9-11,15-16H,5-8H2,1-4H3,(H,20,21)/t15-,16-/m1/s1 |
| InChIKey | HAMGZSVTVXMVKR-HZPDHXFCSA-N |
| XLogP | 4.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|