C22H24F3N3O3 — CID 11774901
(5S)-5-ethynyl-1-[2-[[4-[4-(trifluoromethoxy)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 11774901) has the molecular formula C22H24F3N3O3 and a molecular weight of 435.45 g/mol. Its IUPAC name is (5S)-5-ethynyl-1-[2-[[4-[4-(trifluoromethoxy)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (5S)-5-ethynyl-1-[2-[[4-[4-(trifluoromethoxy)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 11774901 |
| Molecular Formula | C22H24F3N3O3 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | (5S)-5-ethynyl-1-[2-[[4-[4-(trifluoromethoxy)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | C#C[C@@H]1CCC(C#N)N1C(=O)CNC1CCC(Oc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H24F3N3O3/c1-2-16-5-6-17(13-26)28(16)21(29)14-27-15-3-7-18(8-4-15)30-19-9-11-20(12-10-19)31-22(23,24)25/h1,9-12,15-18,27H,3-8,14H2/t15?,16-,17?,18?/m1/s1 |
| InChIKey | CSVIMKJZFIOWQH-JYJOREJMSA-N |
| XLogP | 3.38 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|