C24H24N2O6 — CID 11774923
bis(2-hydroxyethyl) 2,5-dianilinobenzene-1,4-dicarboxylate (PubChem CID 11774923) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is bis(2-hydroxyethyl) 2,5-dianilinobenzene-1,4-dicarboxylate.
| Compound Name | bis(2-hydroxyethyl) 2,5-dianilinobenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 11774923 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | bis(2-hydroxyethyl) 2,5-dianilinobenzene-1,4-dicarboxylate |
| SMILES | O=C(OCCO)c1cc(Nc2ccccc2)c(C(=O)OCCO)cc1Nc1ccccc1 |
| InChI | InChI=1S/C24H24N2O6/c27-11-13-31-23(29)19-16-22(26-18-9-5-2-6-10-18)20(24(30)32-14-12-28)15-21(19)25-17-7-3-1-4-8-17/h1-10,15-16,25-28H,11-14H2 |
| InChIKey | JNWXYYFLUDUXIE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |