C19H19Cl2N3O5 — CID 11775024
(4-nitrophenyl) N-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]carbamate (PubChem CID 11775024) has the molecular formula C19H19Cl2N3O5 and a molecular weight of 440.28 g/mol. Its IUPAC name is (4-nitrophenyl) N-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 11775024 |
| Molecular Formula | C19H19Cl2N3O5 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | (4-nitrophenyl) N-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]carbamate |
| SMILES | O=C(NC[C@H]1CN(Cc2ccc(Cl)c(Cl)c2)CCO1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19Cl2N3O5/c20-17-6-1-13(9-18(17)21)11-23-7-8-28-16(12-23)10-22-19(25)29-15-4-2-14(3-5-15)24(26)27/h1-6,9,16H,7-8,10-12H2,(H,22,25)/t16-/m0/s1 |
| InChIKey | STYCXUAGSTVHRS-INIZCTEOSA-N |
| XLogP | 3.89 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|