C22H40O5Si2 — CID 11775046
(5E)-5-[[(2R,3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxolan-2-yl]methylidene]furan-2-one (PubChem CID 11775046) has the molecular formula C22H40O5Si2 and a molecular weight of 440.73 g/mol. Its IUPAC name is (5E)-5-[[(2R,3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxolan-2-yl]methylidene]furan-2-one.
| Compound Name | (5E)-5-[[(2R,3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxolan-2-yl]methylidene]furan-2-one |
|---|---|
| PubChem CID | 11775046 |
| Molecular Formula | C22H40O5Si2 |
| Molecular Weight | 440.73 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | (5E)-5-[[(2R,3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloxolan-2-yl]methylidene]furan-2-one |
| SMILES | C[C@H]1O[C@H](/C=C2\C=CC(=O)O2)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O5Si2/c1-15-19(26-28(8,9)21(2,3)4)20(27-29(10,11)22(5,6)7)17(24-15)14-16-12-13-18(23)25-16/h12-15,17,19-20H,1-11H3/b16-14+/t15-,17-,19+,20+/m1/s1 |
| InChIKey | FUCCBHDAOWFZQI-LHATXPKSSA-N |
| XLogP | 5.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.73 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|