C11H9BrN2O2 — CID 11778452
7-bromo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,3-dione (PubChem CID 11778452) has the molecular formula C11H9BrN2O2 and a molecular weight of 281.11 g/mol. Its IUPAC name is 7-bromo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,3-dione.
| Compound Name | 7-bromo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,3-dione |
|---|---|
| PubChem CID | 11778452 |
| Molecular Formula | C11H9BrN2O2 |
| Molecular Weight | 281.11 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 7-bromo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,3-dione |
| SMILES | O=c1[nH]c2cc(Br)cc3c2n(c1=O)CCC3 |
| InChI | InChI=1S/C11H9BrN2O2/c12-7-4-6-2-1-3-14-9(6)8(5-7)13-10(15)11(14)16/h4-5H,1-3H2,(H,13,15) |
| InChIKey | LYWIDJXAZHMAOG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.11 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|