C5H10N3S+ — CID 11779154
(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)methanethiol (PubChem CID 11779154) has the molecular formula C5H10N3S+ and a molecular weight of 144.22 g/mol. Its IUPAC name is (2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)methanethiol.
| Compound Name | (2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)methanethiol |
|---|---|
| PubChem CID | 11779154 |
| Molecular Formula | C5H10N3S+ |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | (2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)methanethiol |
| SMILES | Cn1nc[n+](C)c1CS |
| InChI | InChI=1S/C5H9N3S/c1-7-4-6-8(2)5(7)3-9/h4H,3H2,1-2H3/p+1 |
| InChIKey | RHRMFXJXDAIESG-UHFFFAOYSA-O |
| XLogP | -0.33 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|