C14H20O7 — CID 11781545
tert-butyl 3-(methoxymethoxy)-3-(4-methyl-2,5-dioxofuran-3-yl)propanoate (PubChem CID 11781545) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is tert-butyl 3-(methoxymethoxy)-3-(4-methyl-2,5-dioxofuran-3-yl)propanoate.
| Compound Name | tert-butyl 3-(methoxymethoxy)-3-(4-methyl-2,5-dioxofuran-3-yl)propanoate |
|---|---|
| PubChem CID | 11781545 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | tert-butyl 3-(methoxymethoxy)-3-(4-methyl-2,5-dioxofuran-3-yl)propanoate |
| SMILES | COCOC(CC(=O)OC(C)(C)C)C1=C(C)C(=O)OC1=O |
| InChI | InChI=1S/C14H20O7/c1-8-11(13(17)20-12(8)16)9(19-7-18-5)6-10(15)21-14(2,3)4/h9H,6-7H2,1-5H3 |
| InChIKey | YVVNTADHGVHJLH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|