C15H28O7 — CID 10018897
tert-butyl (3R,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-5-oxopentanoate (PubChem CID 10018897) has the molecular formula C15H28O7 and a molecular weight of 320.38 g/mol. Its IUPAC name is tert-butyl (3R,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-5-oxopentanoate.
| Compound Name | tert-butyl (3R,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-5-oxopentanoate |
|---|---|
| PubChem CID | 10018897 |
| Molecular Formula | C15H28O7 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | tert-butyl (3R,4S)-4-(methoxymethoxy)-3-[2-(methoxymethoxy)ethyl]-5-oxopentanoate |
| SMILES | COCOCC[C@H](CC(=O)OC(C)(C)C)[C@@H](C=O)OCOC |
| InChI | InChI=1S/C15H28O7/c1-15(2,3)22-14(17)8-12(6-7-20-10-18-4)13(9-16)21-11-19-5/h9,12-13H,6-8,10-11H2,1-5H3/t12-,13-/m1/s1 |
| InChIKey | JZJPYOJFSQNUKH-CHWSQXEVSA-N |
| XLogP | 1.53 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|