C16H22FNO4 — CID 11781899
(3aR,5R,6S,6aR)-5-[[2-(2-fluorophenyl)ethylamino]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 11781899) has the molecular formula C16H22FNO4 and a molecular weight of 311.35 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-[[2-(2-fluorophenyl)ethylamino]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5R,6S,6aR)-5-[[2-(2-fluorophenyl)ethylamino]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 11781899 |
| Molecular Formula | C16H22FNO4 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-[[2-(2-fluorophenyl)ethylamino]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@H]2O[C@H](CNCCc3ccccc3F)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C16H22FNO4/c1-16(2)21-14-13(19)12(20-15(14)22-16)9-18-8-7-10-5-3-4-6-11(10)17/h3-6,12-15,18-19H,7-9H2,1-2H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | GDCHHUJRGQLISU-LXTVHRRPSA-N |
| XLogP | 1.20 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|