C24H25N3O3 — CID 11784437
(E)-2-benzamido-3-(1-tert-butyl-3-methyl-5-phenylpyrazol-4-yl)prop-2-enoic acid (PubChem CID 11784437) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is (E)-2-benzamido-3-(1-tert-butyl-3-methyl-5-phenylpyrazol-4-yl)prop-2-enoic acid.
| Compound Name | (E)-2-benzamido-3-(1-tert-butyl-3-methyl-5-phenylpyrazol-4-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 11784437 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (E)-2-benzamido-3-(1-tert-butyl-3-methyl-5-phenylpyrazol-4-yl)prop-2-enoic acid |
| SMILES | Cc1nn(C(C)(C)C)c(-c2ccccc2)c1/C=C(/NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H25N3O3/c1-16-19(15-20(23(29)30)25-22(28)18-13-9-6-10-14-18)21(17-11-7-5-8-12-17)27(26-16)24(2,3)4/h5-15H,1-4H3,(H,25,28)(H,29,30)/b20-15+ |
| InChIKey | JDWGADHSMGGUMN-HMMYKYKNSA-N |
| XLogP | 4.47 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|