C26H32N2O6 — CID 11784634
3-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-6,7-dimethoxy-2,3,4,10-tetrahydro-1H-acridin-9-one (PubChem CID 11784634) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is 3-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-6,7-dimethoxy-2,3,4,10-tetrahydro-1H-acridin-9-one.
| Compound Name | 3-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-6,7-dimethoxy-2,3,4,10-tetrahydro-1H-acridin-9-one |
|---|---|
| PubChem CID | 11784634 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 3-[[2-(2,6-dimethoxyphenoxy)ethylamino]methyl]-6,7-dimethoxy-2,3,4,10-tetrahydro-1H-acridin-9-one |
| SMILES | COc1cc2[nH]c3c(c(=O)c2cc1OC)CCC(CNCCOc1c(OC)cccc1OC)C3 |
| InChI | InChI=1S/C26H32N2O6/c1-30-21-6-5-7-22(31-2)26(21)34-11-10-27-15-16-8-9-17-19(12-16)28-20-14-24(33-4)23(32-3)13-18(20)25(17)29/h5-7,13-14,16,27H,8-12,15H2,1-4H3,(H,28,29) |
| InChIKey | VPMYQPYOAXNVFL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|