C23H28F3NO7 — CID 11785060
7-O-tert-butyl 1-O-methyl (1S,2S,4R)-2-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate (PubChem CID 11785060) has the molecular formula C23H28F3NO7 and a molecular weight of 487.47 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O-methyl (1S,2S,4R)-2-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate.
| Compound Name | 7-O-tert-butyl 1-O-methyl (1S,2S,4R)-2-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate |
|---|---|
| PubChem CID | 11785060 |
| Molecular Formula | C23H28F3NO7 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 7-O-tert-butyl 1-O-methyl (1S,2S,4R)-2-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate |
| SMILES | COC(=O)[C@]12CC[C@H](C[C@@H]1OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H28F3NO7/c1-20(2,3)34-19(30)27-15-11-12-21(27,17(28)31-4)16(13-15)33-18(29)22(32-5,23(24,25)26)14-9-7-6-8-10-14/h6-10,15-16H,11-13H2,1-5H3/t15-,16+,21+,22-/m1/s1 |
| InChIKey | FIFLRCBDDBJTFC-LYZACZEUSA-N |
| XLogP | 3.72 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|