C30H50N2O3Si — CID 11785616
[(Z)-2-[(2S,3R,4S)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-1-en-2-ylpyrrolidin-3-yl]ethenyl] N,N-di(propan-2-yl)carbamate (PubChem CID 11785616) has the molecular formula C30H50N2O3Si and a molecular weight of 514.83 g/mol. Its IUPAC name is [(Z)-2-[(2S,3R,4S)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-1-en-2-ylpyrrolidin-3-yl]ethenyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(Z)-2-[(2S,3R,4S)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-1-en-2-ylpyrrolidin-3-yl]ethenyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 11785616 |
| Molecular Formula | C30H50N2O3Si |
| Molecular Weight | 514.83 g/mol |
| Exact Mass | 514.36 |
| IUPAC Name | [(Z)-2-[(2S,3R,4S)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-1-en-2-ylpyrrolidin-3-yl]ethenyl] N,N-di(propan-2-yl)carbamate |
| SMILES | C=C(C)[C@H]1CN(Cc2ccccc2)[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1/C=C\OC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C30H50N2O3Si/c1-22(2)27-20-31(19-25-15-13-12-14-16-25)28(21-35-36(10,11)30(7,8)9)26(27)17-18-34-29(33)32(23(3)4)24(5)6/h12-18,23-24,26-28H,1,19-21H2,2-11H3/b18-17-/t26-,27+,28+/m0/s1 |
| InChIKey | CRHCBCRKFUTMOT-SWBNEQPTSA-N |
| XLogP | 7.47 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.83 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|