C27H48N2O7S — CID 11786090
2-[4-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxycarbonyloxyethyl]piperazin-1-yl]ethanesulfonic acid (PubChem CID 11786090) has the molecular formula C27H48N2O7S and a molecular weight of 544.76 g/mol. Its IUPAC name is 2-[4-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxycarbonyloxyethyl]piperazin-1-yl]ethanesulfonic acid.
| Compound Name | 2-[4-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxycarbonyloxyethyl]piperazin-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 11786090 |
| Molecular Formula | C27H48N2O7S |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | 2-[4-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxycarbonyloxyethyl]piperazin-1-yl]ethanesulfonic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(=O)OCCN1CCN(CCS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C27H48N2O7S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-26(30)36-27(31)35-24-22-28-18-20-29(21-19-28)23-25-37(32,33)34/h6-7,9-10H,2-5,8,11-25H2,1H3,(H,32,33,34)/b7-6-,10-9- |
| InChIKey | LBFBIJUNGSRWLP-HZJYTTRNSA-N |
| XLogP | 4.99 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|