C32H43ClN6O4 — CID 11786829
2-[(2-chloroacetyl)amino]-4-[2-[[2-[4-[(3,5-dibutyl-1,2,4-triazol-1-yl)methyl]phenyl]benzoyl]amino]ethylamino]butanoic acid (PubChem CID 11786829) has the molecular formula C32H43ClN6O4 and a molecular weight of 611.19 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)amino]-4-[2-[[2-[4-[(3,5-dibutyl-1,2,4-triazol-1-yl)methyl]phenyl]benzoyl]amino]ethylamino]butanoic acid.
| Compound Name | 2-[(2-chloroacetyl)amino]-4-[2-[[2-[4-[(3,5-dibutyl-1,2,4-triazol-1-yl)methyl]phenyl]benzoyl]amino]ethylamino]butanoic acid |
|---|---|
| PubChem CID | 11786829 |
| Molecular Formula | C32H43ClN6O4 |
| Molecular Weight | 611.19 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | 2-[(2-chloroacetyl)amino]-4-[2-[[2-[4-[(3,5-dibutyl-1,2,4-triazol-1-yl)methyl]phenyl]benzoyl]amino]ethylamino]butanoic acid |
| SMILES | CCCCc1nc(CCCC)n(Cc2ccc(-c3ccccc3C(=O)NCCNCCC(NC(=O)CCl)C(=O)O)cc2)n1 |
| InChI | InChI=1S/C32H43ClN6O4/c1-3-5-11-28-37-29(12-6-4-2)39(38-28)22-23-13-15-24(16-14-23)25-9-7-8-10-26(25)31(41)35-20-19-34-18-17-27(32(42)43)36-30(40)21-33/h7-10,13-16,27,34H,3-6,11-12,17-22H2,1-2H3,(H,35,41)(H,36,40)(H,42,43) |
| InChIKey | PRZULCQZQJIOKY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 138.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.19 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|